About [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene
[(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene (PubChem CID 57398583) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene.
Molecular Properties
| Compound Name | [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene |
| PubChem CID | 57398583 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene |
| SMILES | COCO[C@H](c1ccccc1)[C@@H](CN=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-21-13-22-17(15-10-6-3-7-11-15)16(12-19-20-18)14-8-4-2-5-9-14/h2-11,16-17H,12-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | UQJXLLYGPUFSRM-DLBZAZTESA-N |
| XLogP | 4.44 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene?
The IUPAC name of [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene (CID 57398583) is [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene.
What is the SMILES notation for [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene?
The canonical SMILES for [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene is COCO[C@H](c1ccccc1)[C@@H](CN=[N+]=[N-])c1ccccc1.
What is the InChIKey of [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene?
The InChIKey is UQJXLLYGPUFSRM-DLBZAZTESA-N. The full InChI is InChI=1S/C17H19N3O2/c1-21-13-22-17(15-10-6-3-7-11-15)16(12-19-20-18)14-8-4-2-5-9-14/h2-11,16-17H,12-13H2,1H3/t16-,17+/m0/s1.
What are the key properties of [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene?
[(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene has a molecular weight of 297.36 g/mol, XLogP of 4.44, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-3-azido-1-(methoxymethoxy)-1-phenylpropan-2-yl]benzene is sourced from PubChem (CID 57398583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).