C19H17N7O — CID 57398676
11-(furan-2-yl)-4-(3-phenylpropyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine (PubChem CID 57398676) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 11-(furan-2-yl)-4-(3-phenylpropyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine.
| Compound Name | 11-(furan-2-yl)-4-(3-phenylpropyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 57398676 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 11-(furan-2-yl)-4-(3-phenylpropyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaen-8-amine |
| SMILES | Nc1nc2cn(CCCc3ccccc3)nc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C19H17N7O/c20-19-21-14-12-25(10-4-8-13-6-2-1-3-7-13)23-16(14)18-22-17(24-26(18)19)15-9-5-11-27-15/h1-3,5-7,9,11-12H,4,8,10H2,(H2,20,21) |
| InChIKey | MTHYDGIDFZWZRZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |