About 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid
3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid (PubChem CID 57398847) has the molecular formula C20H15N5O3
and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid |
| PubChem CID | 57398847 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(-c2ccnc3nc[nH]c23)cc1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H15N5O3/c26-19(27)13-2-1-3-15(10-13)25-20(28)24-14-6-4-12(5-7-14)16-8-9-21-18-17(16)22-11-23-18/h1-11H,(H,26,27)(H,21,22,23)(H2,24,25,28) |
| InChIKey | YOAWWJYNFIIHJK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid?
The IUPAC name of 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid (CID 57398847) is 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid.
What is the SMILES notation for 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid?
The canonical SMILES for 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid is O=C(Nc1ccc(-c2ccnc3nc[nH]c23)cc1)Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid?
The InChIKey is YOAWWJYNFIIHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O3/c26-19(27)13-2-1-3-15(10-13)25-20(28)24-14-6-4-12(5-7-14)16-8-9-21-18-17(16)22-11-23-18/h1-11H,(H,26,27)(H,21,22,23)(H2,24,25,28).
What are the key properties of 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid?
3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid has a molecular weight of 373.37 g/mol, XLogP of 3.97, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]carbamoylamino]benzoic acid is sourced from PubChem (CID 57398847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).