C23H24F2N2O4S — CID 57399011
methyl 9-[3-[(3,5-difluorophenyl)sulfonylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57399011) has the molecular formula C23H24F2N2O4S and a molecular weight of 462.52 g/mol. Its IUPAC name is methyl 9-[3-[(3,5-difluorophenyl)sulfonylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[3-[(3,5-difluorophenyl)sulfonylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57399011 |
| Molecular Formula | C23H24F2N2O4S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | methyl 9-[3-[(3,5-difluorophenyl)sulfonylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCNS(=O)(=O)c2cc(F)cc(F)c2)CCCC1 |
| InChI | InChI=1S/C23H24F2N2O4S/c1-31-23(28)15-7-8-22-20(11-15)19-5-2-3-6-21(19)27(22)10-4-9-26-32(29,30)18-13-16(24)12-17(25)14-18/h7-8,11-14,26H,2-6,9-10H2,1H3 |
| InChIKey | KCUSBSLBAVTMPD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|