C17H23N3O7 — CID 57399085
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol (PubChem CID 57399085) has the molecular formula C17H23N3O7 and a molecular weight of 381.39 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 57399085 |
| Molecular Formula | C17H23N3O7 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cn2cc(CO[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)nn2)cc1 |
| InChI | InChI=1S/C17H23N3O7/c1-25-12-4-2-10(3-5-12)6-20-7-11(18-19-20)9-26-17-16(24)15(23)14(22)13(8-21)27-17/h2-5,7,13-17,21-24H,6,8-9H2,1H3/t13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | IELWRFDOQYKXIP-NRKLIOEPSA-N |
| XLogP | -1.35 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |