C25H30O3 — CID 57399131
(6aR,8aS,14bR)-3,3,6,6,8a-pentamethyl-2,4,6a,7,8,14b-hexahydrochromeno[4,3-a]xanthen-1-one (PubChem CID 57399131) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is (6aR,8aS,14bR)-3,3,6,6,8a-pentamethyl-2,4,6a,7,8,14b-hexahydrochromeno[4,3-a]xanthen-1-one.
| Compound Name | (6aR,8aS,14bR)-3,3,6,6,8a-pentamethyl-2,4,6a,7,8,14b-hexahydrochromeno[4,3-a]xanthen-1-one |
|---|---|
| PubChem CID | 57399131 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (6aR,8aS,14bR)-3,3,6,6,8a-pentamethyl-2,4,6a,7,8,14b-hexahydrochromeno[4,3-a]xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(C)(C)[C@@H]1CC[C@]3(C)Oc4ccccc4C=C3[C@H]21 |
| InChI | InChI=1S/C25H30O3/c1-23(2)13-18(26)22-20(14-23)27-24(3,4)16-10-11-25(5)17(21(16)22)12-15-8-6-7-9-19(15)28-25/h6-9,12,16,21H,10-11,13-14H2,1-5H3/t16-,21-,25+/m1/s1 |
| InChIKey | VZBSHPZKUIYKKR-YCEDGAFSSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |