C20H26O4 — CID 57399200
(1S,2S,9S,11R)-4,13,13-trimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione (PubChem CID 57399200) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1S,2S,9S,11R)-4,13,13-trimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione.
| Compound Name | (1S,2S,9S,11R)-4,13,13-trimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione |
|---|---|
| PubChem CID | 57399200 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1S,2S,9S,11R)-4,13,13-trimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione |
| SMILES | CC(C)=CC[C@@]12OC(C)(C)[C@@H]3C[C@@H](C=C4C(=O)CC(C)O[C@]431)C2=O |
| InChI | InChI=1S/C20H26O4/c1-11(2)6-7-19-17(22)13-9-14-15(21)8-12(3)23-20(14,19)16(10-13)18(4,5)24-19/h6,9,12-13,16H,7-8,10H2,1-5H3/t12?,13-,16+,19+,20-/m1/s1 |
| InChIKey | REMHECGSDXLQKX-QVWRPPTISA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|