C18H20N4S — CID 57399278
4-[(4-cyclohexylsulfanyl-5-methylpyrimidin-2-yl)amino]benzonitrile (PubChem CID 57399278) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-[(4-cyclohexylsulfanyl-5-methylpyrimidin-2-yl)amino]benzonitrile.
| Compound Name | 4-[(4-cyclohexylsulfanyl-5-methylpyrimidin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 57399278 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-[(4-cyclohexylsulfanyl-5-methylpyrimidin-2-yl)amino]benzonitrile |
| SMILES | Cc1cnc(Nc2ccc(C#N)cc2)nc1SC1CCCCC1 |
| InChI | InChI=1S/C18H20N4S/c1-13-12-20-18(21-15-9-7-14(11-19)8-10-15)22-17(13)23-16-5-3-2-4-6-16/h7-10,12,16H,2-6H2,1H3,(H,20,21,22) |
| InChIKey | IRFFOUDSWXZFCF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |