C31H39NO4 — CID 57399360
2-[3-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 57399360) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[3-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57399360 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 2-[3-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | CC(C)c1c(OCC(O)CN2C(=O)c3ccccc3C2=O)ccc2c1CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C31H39NO4/c1-19(2)27-23-11-14-26-30(3,4)15-8-16-31(26,5)24(23)12-13-25(27)36-18-20(33)17-32-28(34)21-9-6-7-10-22(21)29(32)35/h6-7,9-10,12-13,19-20,26,33H,8,11,14-18H2,1-5H3/t20?,26-,31+/m0/s1 |
| InChIKey | SDEPBMNLTHANHE-HNFXXBQPSA-N |
| XLogP | 5.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|