C20H34ClNS — CID 57399364
3,3-dimethyl-1-[5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pentyl]piperidine;hydrochloride (PubChem CID 57399364) has the molecular formula C20H34ClNS and a molecular weight of 356.02 g/mol. Its IUPAC name is 3,3-dimethyl-1-[5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pentyl]piperidine;hydrochloride.
| Compound Name | 3,3-dimethyl-1-[5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pentyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 57399364 |
| Molecular Formula | C20H34ClNS |
| Molecular Weight | 356.02 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 3,3-dimethyl-1-[5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pentyl]piperidine;hydrochloride |
| SMILES | CC1(C)CCCN(CCCCCC2CCCc3sccc32)C1.Cl |
| InChI | InChI=1S/C20H33NS.ClH/c1-20(2)12-7-14-21(16-20)13-5-3-4-8-17-9-6-10-19-18(17)11-15-22-19;/h11,15,17H,3-10,12-14,16H2,1-2H3;1H |
| InChIKey | JLHHMMWQWYSMDK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.02 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|