C7H11BO3 — CID 573994
2-ethyl-4,7a-dihydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran (PubChem CID 573994) has the molecular formula C7H11BO3 and a molecular weight of 153.97 g/mol. Its IUPAC name is 2-ethyl-4,7a-dihydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran.
| Compound Name | 2-ethyl-4,7a-dihydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran |
|---|---|
| PubChem CID | 573994 |
| Molecular Formula | C7H11BO3 |
| Molecular Weight | 153.97 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 2-ethyl-4,7a-dihydro-3aH-[1,3,2]dioxaborolo[4,5-c]pyran |
| SMILES | CCB1OC2C=COCC2O1 |
| InChI | InChI=1S/C7H11BO3/c1-2-8-10-6-3-4-9-5-7(6)11-8/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | ZWZIZVCMAGSQHT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.97 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|