C29H32N2O — CID 57399447
(1S,14R,15R)-25-(cyclopentylmethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaen-20-ol (PubChem CID 57399447) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is (1S,14R,15R)-25-(cyclopentylmethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaen-20-ol.
| Compound Name | (1S,14R,15R)-25-(cyclopentylmethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaen-20-ol |
|---|---|
| PubChem CID | 57399447 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (1S,14R,15R)-25-(cyclopentylmethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaen-20-ol |
| SMILES | Oc1ccc2c(c1)[C@]13CCN(CC4CCCC4)[C@H](C2)[C@@H]1Cc1cc2ccccc2nc1C3 |
| InChI | InChI=1S/C29H32N2O/c32-23-10-9-20-15-28-25-14-22-13-21-7-3-4-8-26(21)30-27(22)17-29(25,24(20)16-23)11-12-31(28)18-19-5-1-2-6-19/h3-4,7-10,13,16,19,25,28,32H,1-2,5-6,11-12,14-15,17-18H2/t25-,28+,29+/m0/s1 |
| InChIKey | YJJLLHJSPMLHJN-RFYMFKDESA-N |
| XLogP | 5.41 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |