About 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline
7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline (PubChem CID 57399485) has the molecular formula C16H9BrN4O2
and a molecular weight of 369.18 g/mol. Its IUPAC name is 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline |
| PubChem CID | 57399485 |
| Molecular Formula | C16H9BrN4O2 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc2c(cnc3cc(Br)ccc32)[nH]1 |
| InChI | InChI=1S/C16H9BrN4O2/c17-9-5-6-10-12(7-9)18-8-13-15(10)20-16(19-13)11-3-1-2-4-14(11)21(22)23/h1-8H,(H,19,20) |
| InChIKey | DTEQOLGYYWWQRS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline?
The IUPAC name of 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline (CID 57399485) is 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline.
What is the SMILES notation for 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline?
The canonical SMILES for 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline is O=[N+]([O-])c1ccccc1-c1nc2c(cnc3cc(Br)ccc32)[nH]1.
What is the InChIKey of 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline?
The InChIKey is DTEQOLGYYWWQRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9BrN4O2/c17-9-5-6-10-12(7-9)18-8-13-15(10)20-16(19-13)11-3-1-2-4-14(11)21(22)23/h1-8H,(H,19,20).
What are the key properties of 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline?
7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline has a molecular weight of 369.18 g/mol, XLogP of 4.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-(2-nitrophenyl)-3H-imidazo[4,5-c]quinoline is sourced from PubChem (CID 57399485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).