About 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide
2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide (PubChem CID 57399521) has the molecular formula C20H14F3N3O4
and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide.
Molecular Properties
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide |
| PubChem CID | 57399521 |
| Molecular Formula | C20H14F3N3O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1cc(Oc2ccc3c(c2)OCO3)ncc1C(F)(F)F |
| InChI | InChI=1S/C20H14F3N3O4/c21-20(22,23)13-9-25-18(30-11-5-6-16-17(7-11)29-10-28-16)8-15(13)26-14-4-2-1-3-12(14)19(24)27/h1-9H,10H2,(H2,24,27)(H,25,26) |
| InChIKey | ZDJZJCGVCBBGDA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
The IUPAC name of 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide (CID 57399521) is 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide.
What is the SMILES notation for 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
The canonical SMILES for 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide is NC(=O)c1ccccc1Nc1cc(Oc2ccc3c(c2)OCO3)ncc1C(F)(F)F.
What is the InChIKey of 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
The InChIKey is ZDJZJCGVCBBGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N3O4/c21-20(22,23)13-9-25-18(30-11-5-6-16-17(7-11)29-10-28-16)8-15(13)26-14-4-2-1-3-12(14)19(24)27/h1-9H,10H2,(H2,24,27)(H,25,26).
What are the key properties of 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide?
2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide has a molecular weight of 417.34 g/mol, XLogP of 4.46, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1,3-benzodioxol-5-yloxy)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide is sourced from PubChem (CID 57399521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).