About 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid
1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid (PubChem CID 57399615) has the molecular formula C20H18N2O4
and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid |
| PubChem CID | 57399615 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(-c2ccc([N+](=O)[O-])cc2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N2O4/c1-13-18(16-8-10-17(11-9-16)22(25)26)19(20(23)24)14(2)21(13)12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,23,24) |
| InChIKey | QCONXDTVGZBBCZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid?
The IUPAC name of 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid (CID 57399615) is 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid.
What is the SMILES notation for 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid?
The canonical SMILES for 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid is Cc1c(C(=O)O)c(-c2ccc([N+](=O)[O-])cc2)c(C)n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid?
The InChIKey is QCONXDTVGZBBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4/c1-13-18(16-8-10-17(11-9-16)22(25)26)19(20(23)24)14(2)21(13)12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,23,24).
What are the key properties of 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid?
1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid has a molecular weight of 350.37 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylic acid is sourced from PubChem (CID 57399615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).