C19H24F2N2O — CID 57399616
N,N-diethyl-7-fluoro-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide (PubChem CID 57399616) has the molecular formula C19H24F2N2O and a molecular weight of 334.41 g/mol. Its IUPAC name is N,N-diethyl-7-fluoro-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide.
| Compound Name | N,N-diethyl-7-fluoro-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 57399616 |
| Molecular Formula | C19H24F2N2O |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N,N-diethyl-7-fluoro-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCc2c1c1ccc(F)cc1n2CCF |
| InChI | InChI=1S/C19H24F2N2O/c1-3-22(4-2)19(24)15-6-5-7-16-18(15)14-9-8-13(21)12-17(14)23(16)11-10-20/h8-9,12,15H,3-7,10-11H2,1-2H3 |
| InChIKey | QJLZJESMFQBPJH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|