C33H33N2S+ — CID 57399673
4-[(E)-2-[3-(4,4-diphenylbutyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 57399673) has the molecular formula C33H33N2S+ and a molecular weight of 489.71 g/mol. Its IUPAC name is 4-[(E)-2-[3-(4,4-diphenylbutyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[3-(4,4-diphenylbutyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 57399673 |
| Molecular Formula | C33H33N2S+ |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 4-[(E)-2-[3-(4,4-diphenylbutyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccccc3[n+]2CCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N2S/c1-34(2)29-22-19-26(20-23-29)21-24-33-35(31-17-9-10-18-32(31)36-33)25-11-16-30(27-12-5-3-6-13-27)28-14-7-4-8-15-28/h3-10,12-15,17-24,30H,11,16,25H2,1-2H3/q+1 |
| InChIKey | YGOFUOGIIMAONQ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|