C14H22N4O2S3 — CID 57399737
N-[5-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]pentyl]methanesulfonamide (PubChem CID 57399737) has the molecular formula C14H22N4O2S3 and a molecular weight of 374.56 g/mol. Its IUPAC name is N-[5-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]pentyl]methanesulfonamide.
| Compound Name | N-[5-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]pentyl]methanesulfonamide |
|---|---|
| PubChem CID | 57399737 |
| Molecular Formula | C14H22N4O2S3 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[5-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]pentyl]methanesulfonamide |
| SMILES | Cc1nc(C)c(-c2csc(NCCCCCNS(C)(=O)=O)n2)s1 |
| InChI | InChI=1S/C14H22N4O2S3/c1-10-13(22-11(2)17-10)12-9-21-14(18-12)15-7-5-4-6-8-16-23(3,19)20/h9,16H,4-8H2,1-3H3,(H,15,18) |
| InChIKey | UOHHRRUERFHSGG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|