C19H25FN2O2 — CID 57399770
N,N-diethyl-9-(2-fluoroethyl)-6-hydroxy-1,2,3,4-tetrahydrocarbazole-4-carboxamide (PubChem CID 57399770) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is N,N-diethyl-9-(2-fluoroethyl)-6-hydroxy-1,2,3,4-tetrahydrocarbazole-4-carboxamide.
| Compound Name | N,N-diethyl-9-(2-fluoroethyl)-6-hydroxy-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 57399770 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | N,N-diethyl-9-(2-fluoroethyl)-6-hydroxy-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCc2c1c1cc(O)ccc1n2CCF |
| InChI | InChI=1S/C19H25FN2O2/c1-3-21(4-2)19(24)14-6-5-7-17-18(14)15-12-13(23)8-9-16(15)22(17)11-10-20/h8-9,12,14,23H,3-7,10-11H2,1-2H3 |
| InChIKey | OYYWZOCFFUKRPC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|