C21H26N2O — CID 57399807
(E,2R,3S,6S)-3-ethyl-N-methoxy-1-methyl-2,6-diphenylpiperidin-4-imine (PubChem CID 57399807) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (E,2R,3S,6S)-3-ethyl-N-methoxy-1-methyl-2,6-diphenylpiperidin-4-imine.
| Compound Name | (E,2R,3S,6S)-3-ethyl-N-methoxy-1-methyl-2,6-diphenylpiperidin-4-imine |
|---|---|
| PubChem CID | 57399807 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (E,2R,3S,6S)-3-ethyl-N-methoxy-1-methyl-2,6-diphenylpiperidin-4-imine |
| SMILES | CC[C@@H]1/C(=N/OC)C[C@@H](c2ccccc2)N(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-4-18-19(22-24-3)15-20(16-11-7-5-8-12-16)23(2)21(18)17-13-9-6-10-14-17/h5-14,18,20-21H,4,15H2,1-3H3/b22-19+/t18-,20+,21+/m1/s1 |
| InChIKey | BEAUKYYFWRNDKJ-CDGAWMLISA-N |
| XLogP | 4.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|