C32H40N2O6S — CID 57400068
[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 8-aminooctanoate (PubChem CID 57400068) has the molecular formula C32H40N2O6S and a molecular weight of 580.75 g/mol. Its IUPAC name is [2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 8-aminooctanoate.
| Compound Name | [2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 8-aminooctanoate |
|---|---|
| PubChem CID | 57400068 |
| Molecular Formula | C32H40N2O6S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | [2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] 8-aminooctanoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCCCCCCN)CCC(C)(COc1ccc(/C=C3\SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C32H40N2O6S/c1-20-21(2)29-25(22(3)28(20)39-27(35)10-8-6-5-7-9-17-33)15-16-32(4,40-29)19-38-24-13-11-23(12-14-24)18-26-30(36)34-31(37)41-26/h11-14,18H,5-10,15-17,19,33H2,1-4H3,(H,34,36,37)/b26-18- |
| InChIKey | ABABGOMCKUKBIN-ITYLOYPMSA-N |
| XLogP | 6.30 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|