C21H34N2O2S — CID 57400104
N-[3-[(1R,5S)-3-hexyl-6-methyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]propane-1-sulfonamide (PubChem CID 57400104) has the molecular formula C21H34N2O2S and a molecular weight of 378.58 g/mol. Its IUPAC name is N-[3-[(1R,5S)-3-hexyl-6-methyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]propane-1-sulfonamide.
| Compound Name | N-[3-[(1R,5S)-3-hexyl-6-methyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 57400104 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[3-[(1R,5S)-3-hexyl-6-methyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]propane-1-sulfonamide |
| SMILES | CCCCCCN1C[C@@H]2[C@H](C1)C2(C)c1cccc(NS(=O)(=O)CCC)c1 |
| InChI | InChI=1S/C21H34N2O2S/c1-4-6-7-8-12-23-15-19-20(16-23)21(19,3)17-10-9-11-18(14-17)22-26(24,25)13-5-2/h9-11,14,19-20,22H,4-8,12-13,15-16H2,1-3H3/t19-,20+,21? |
| InChIKey | OWZMGDCDTNNHGX-WCRBZPEASA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|