About N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide
N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide (PubChem CID 57400105) has the molecular formula C21H34N2O2S
and a molecular weight of 378.58 g/mol. Its IUPAC name is N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide |
| PubChem CID | 57400105 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide |
| SMILES | CCCCCCN1C[C@@H]2[C@H](C1)C2(CCC)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H34N2O2S/c1-4-6-7-8-13-23-15-19-20(16-23)21(19,12-5-2)17-10-9-11-18(14-17)22-26(3,24)25/h9-11,14,19-20,22H,4-8,12-13,15-16H2,1-3H3/t19-,20+,21? |
| InChIKey | JUCCUNKUZWGLKZ-WCRBZPEASA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide (CID 57400105) is N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide is CCCCCCN1C[C@@H]2[C@H](C1)C2(CCC)c1cccc(NS(C)(=O)=O)c1.
What is the InChIKey of N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide?
The InChIKey is JUCCUNKUZWGLKZ-WCRBZPEASA-N. The full InChI is InChI=1S/C21H34N2O2S/c1-4-6-7-8-13-23-15-19-20(16-23)21(19,12-5-2)17-10-9-11-18(14-17)22-26(3,24)25/h9-11,14,19-20,22H,4-8,12-13,15-16H2,1-3H3/t19-,20+,21?.
What are the key properties of N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide?
N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide has a molecular weight of 378.58 g/mol, XLogP of 4.24, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(1R,5S)-3-hexyl-6-propyl-3-azabicyclo[3.1.0]hexan-6-yl]phenyl]methanesulfonamide is sourced from PubChem (CID 57400105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).