About 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid
5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 57400203) has the molecular formula C18H11N3O2
and a molecular weight of 301.31 g/mol. Its IUPAC name is 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid.
Molecular Properties
| Compound Name | 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid |
| PubChem CID | 57400203 |
| Molecular Formula | C18H11N3O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1cccnc1)c1ccncc12 |
| InChI | InChI=1S/C18H11N3O2/c22-18(23)11-3-4-13-15-10-20-7-5-14(15)17(21-16(13)8-11)12-2-1-6-19-9-12/h1-10H,(H,22,23) |
| InChIKey | MLHDFKOOYRVEDH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid?
The IUPAC name of 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid (CID 57400203) is 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid.
What is the SMILES notation for 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid?
The canonical SMILES for 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid is O=C(O)c1ccc2c(c1)nc(-c1cccnc1)c1ccncc12.
What is the InChIKey of 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid?
The InChIKey is MLHDFKOOYRVEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O2/c22-18(23)11-3-4-13-15-10-20-7-5-14(15)17(21-16(13)8-11)12-2-1-6-19-9-12/h1-10H,(H,22,23).
What are the key properties of 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid?
5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid has a molecular weight of 301.31 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid is sourced from PubChem (CID 57400203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).