About 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide (PubChem CID 57400252) has the molecular formula C10H18ClIN6O
and a molecular weight of 400.65 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide.
Molecular Properties
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide |
| PubChem CID | 57400252 |
| Molecular Formula | C10H18ClIN6O |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCNC(=O)c1nc(Cl)c(N)nc1N.[I-] |
| InChI | InChI=1S/C10H17ClN6O.HI/c1-17(2,3)5-4-14-10(18)6-8(12)16-9(13)7(11)15-6;/h4-5H2,1-3H3,(H4-,12,13,14,16,18);1H |
| InChIKey | HGJWKMXLSNAQRG-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide?
The IUPAC name of 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide (CID 57400252) is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide.
What is the SMILES notation for 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide?
The canonical SMILES for 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide is C[N+](C)(C)CCNC(=O)c1nc(Cl)c(N)nc1N.[I-].
What is the InChIKey of 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide?
The InChIKey is HGJWKMXLSNAQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClN6O.HI/c1-17(2,3)5-4-14-10(18)6-8(12)16-9(13)7(11)15-6;/h4-5H2,1-3H3,(H4-,12,13,14,16,18);1H.
What are the key properties of 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide?
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide has a molecular weight of 400.65 g/mol, XLogP of -3.27, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-trimethylazanium iodide is sourced from PubChem (CID 57400252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).