About ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate
ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate (PubChem CID 57400293) has the molecular formula C25H24Cl2N2O2
and a molecular weight of 455.39 g/mol. Its IUPAC name is ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate |
| PubChem CID | 57400293 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc(-c2ccccc2)nc1N1CCCCC1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-2-31-25(30)23-19(18-11-12-20(26)21(27)15-18)16-22(17-9-5-3-6-10-17)28-24(23)29-13-7-4-8-14-29/h3,5-6,9-12,15-16H,2,4,7-8,13-14H2,1H3 |
| InChIKey | OPQFWHLNTZETFQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate?
The IUPAC name of ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate (CID 57400293) is ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate?
The canonical SMILES for ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate is CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc(-c2ccccc2)nc1N1CCCCC1.
What is the InChIKey of ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate?
The InChIKey is OPQFWHLNTZETFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24Cl2N2O2/c1-2-31-25(30)23-19(18-11-12-20(26)21(27)15-18)16-22(17-9-5-3-6-10-17)28-24(23)29-13-7-4-8-14-29/h3,5-6,9-12,15-16H,2,4,7-8,13-14H2,1H3.
What are the key properties of ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate?
ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate has a molecular weight of 455.39 g/mol, XLogP of 6.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,4-dichlorophenyl)-6-phenyl-2-piperidin-1-ylpyridine-3-carboxylate is sourced from PubChem (CID 57400293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).