C20H29FN2O3S — CID 57400305
N-cycloheptyl-1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 57400305) has the molecular formula C20H29FN2O3S and a molecular weight of 396.53 g/mol. Its IUPAC name is N-cycloheptyl-1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-cycloheptyl-1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 57400305 |
| Molecular Formula | C20H29FN2O3S |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-cycloheptyl-1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCC(C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C20H29FN2O3S/c1-15-14-17(21)8-9-19(15)27(25,26)23-12-10-16(11-13-23)20(24)22-18-6-4-2-3-5-7-18/h8-9,14,16,18H,2-7,10-13H2,1H3,(H,22,24) |
| InChIKey | RZGMYSQGNODGBR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |