C34H32O6 — CID 57400320
(5aR,11aR,12S)-1,10-dimethoxy-5a-(4-methoxyphenyl)-12-[(E)-2-(4-methoxyphenyl)ethenyl]-11a,12-dihydro-11H-chromeno[2,3-b]chromene (PubChem CID 57400320) has the molecular formula C34H32O6 and a molecular weight of 536.62 g/mol. Its IUPAC name is (5aR,11aR,12S)-1,10-dimethoxy-5a-(4-methoxyphenyl)-12-[(E)-2-(4-methoxyphenyl)ethenyl]-11a,12-dihydro-11H-chromeno[2,3-b]chromene.
| Compound Name | (5aR,11aR,12S)-1,10-dimethoxy-5a-(4-methoxyphenyl)-12-[(E)-2-(4-methoxyphenyl)ethenyl]-11a,12-dihydro-11H-chromeno[2,3-b]chromene |
|---|---|
| PubChem CID | 57400320 |
| Molecular Formula | C34H32O6 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (5aR,11aR,12S)-1,10-dimethoxy-5a-(4-methoxyphenyl)-12-[(E)-2-(4-methoxyphenyl)ethenyl]-11a,12-dihydro-11H-chromeno[2,3-b]chromene |
| SMILES | COc1ccc(/C=C/[C@@H]2c3c(OC)cccc3O[C@]3(c4ccc(OC)cc4)Oc4cccc(OC)c4C[C@H]23)cc1 |
| InChI | InChI=1S/C34H32O6/c1-35-24-16-11-22(12-17-24)13-20-26-28-21-27-29(37-3)7-5-8-30(27)39-34(28,23-14-18-25(36-2)19-15-23)40-32-10-6-9-31(38-4)33(26)32/h5-20,26,28H,21H2,1-4H3/b20-13+/t26-,28+,34-/m0/s1 |
| InChIKey | NKVDLSWESNPDMT-ASWHUNFKSA-N |
| XLogP | 7.01 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |