C31H34O2 — CID 57400334
(8R,9S,13S,14S,17R)-13-methyl-17-[(4-phenylphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 57400334) has the molecular formula C31H34O2 and a molecular weight of 438.61 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-13-methyl-17-[(4-phenylphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-13-methyl-17-[(4-phenylphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 57400334 |
| Molecular Formula | C31H34O2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methyl-17-[(4-phenylphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34O2/c1-30-17-15-27-26-14-12-25(32)19-24(26)11-13-28(27)29(30)16-18-31(30,33)20-21-7-9-23(10-8-21)22-5-3-2-4-6-22/h2-10,12,14,19,27-29,32-33H,11,13,15-18,20H2,1H3/t27-,28-,29+,30+,31-/m1/s1 |
| InChIKey | MPOKUZQIPUCUNH-ZOROSQJXSA-N |
| XLogP | 6.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |