C22H25Cl2N3O2 — CID 57400380
[3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 57400380) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(2-methylpiperidin-1-yl)methanone.
| Compound Name | [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 57400380 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [3-[(4-chlorophenyl)-(2-chloro-3-pyridinyl)methoxy]azetidin-1-yl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCCN1C(=O)N1CC(OC(c2ccc(Cl)cc2)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-15-5-2-3-12-27(15)22(28)26-13-18(14-26)29-20(16-7-9-17(23)10-8-16)19-6-4-11-25-21(19)24/h4,6-11,15,18,20H,2-3,5,12-14H2,1H3 |
| InChIKey | RAXGEMNHDSGMEN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|