About 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine
2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine (PubChem CID 57400467) has the molecular formula C15H12Cl3NO2
and a molecular weight of 344.63 g/mol. Its IUPAC name is 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine.
Molecular Properties
| Compound Name | 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine |
| PubChem CID | 57400467 |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine |
| SMILES | C=Cc1ccc(OCCOc2ccc(Cl)cc2Cl)c(Cl)n1 |
| InChI | InChI=1S/C15H12Cl3NO2/c1-2-11-4-6-14(15(18)19-11)21-8-7-20-13-5-3-10(16)9-12(13)17/h2-6,9H,1,7-8H2 |
| InChIKey | LNMIMKUXSGGSCZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine?
The IUPAC name of 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine (CID 57400467) is 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine.
What is the SMILES notation for 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine?
The canonical SMILES for 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine is C=Cc1ccc(OCCOc2ccc(Cl)cc2Cl)c(Cl)n1.
What is the InChIKey of 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine?
The InChIKey is LNMIMKUXSGGSCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl3NO2/c1-2-11-4-6-14(15(18)19-11)21-8-7-20-13-5-3-10(16)9-12(13)17/h2-6,9H,1,7-8H2.
What are the key properties of 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine?
2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine has a molecular weight of 344.63 g/mol, XLogP of 5.14, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-ethenylpyridine is sourced from PubChem (CID 57400467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).