C24H24N2O3 — CID 57400552
[5-(1-benzylindazol-3-yl)furan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 57400552) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is [5-(1-benzylindazol-3-yl)furan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [5-(1-benzylindazol-3-yl)furan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57400552 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [5-(1-benzylindazol-3-yl)furan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(-c2nn(Cc3ccccc3)c3ccccc23)o1 |
| InChI | InChI=1S/C24H24N2O3/c1-24(2,3)23(27)28-16-18-13-14-21(29-18)22-19-11-7-8-12-20(19)26(25-22)15-17-9-5-4-6-10-17/h4-14H,15-16H2,1-3H3 |
| InChIKey | PCEDMSXAUCMJBA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |