C27H39N3O4 — CID 57400562
N-[4-[4-[4-(2-ethoxyethoxymethyl)-2-methoxyphenyl]piperazin-1-yl]butyl]benzamide (PubChem CID 57400562) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[4-[4-[4-(2-ethoxyethoxymethyl)-2-methoxyphenyl]piperazin-1-yl]butyl]benzamide.
| Compound Name | N-[4-[4-[4-(2-ethoxyethoxymethyl)-2-methoxyphenyl]piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 57400562 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | N-[4-[4-[4-(2-ethoxyethoxymethyl)-2-methoxyphenyl]piperazin-1-yl]butyl]benzamide |
| SMILES | CCOCCOCc1ccc(N2CCN(CCCCNC(=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H39N3O4/c1-3-33-19-20-34-22-23-11-12-25(26(21-23)32-2)30-17-15-29(16-18-30)14-8-7-13-28-27(31)24-9-5-4-6-10-24/h4-6,9-12,21H,3,7-8,13-20,22H2,1-2H3,(H,28,31) |
| InChIKey | CYHIQHDBFGBIFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|