C18H15N5O4S — CID 57400582
3-[[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoic acid (PubChem CID 57400582) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is 3-[[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 57400582 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-[[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)N(C)/N=C/c1cnn2ccc(C#N)cc12 |
| InChI | InChI=1S/C18H15N5O4S/c1-12-3-4-14(18(24)25)8-17(12)28(26,27)22(2)20-10-15-11-21-23-6-5-13(9-19)7-16(15)23/h3-8,10-11H,1-2H3,(H,24,25)/b20-10+ |
| InChIKey | UZOOWFHDBFUOFT-KEBDBYFISA-N |
| XLogP | 1.87 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|