C23H32N2O3 — CID 57400723
methyl 9-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57400723) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is methyl 9-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57400723 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | methyl 9-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCN2C[C@@H](C)O[C@@H](C)C2)CCCC1 |
| InChI | InChI=1S/C23H32N2O3/c1-16-14-24(15-17(2)28-16)11-6-12-25-21-8-5-4-7-19(21)20-13-18(23(26)27-3)9-10-22(20)25/h9-10,13,16-17H,4-8,11-12,14-15H2,1-3H3/t16-,17+ |
| InChIKey | GGDCVBKOCBRZDT-CALCHBBNSA-N |
| XLogP | 3.81 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|