C21H27N3O3 — CID 57400725
methyl 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57400725) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is methyl 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57400725 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | methyl 9-[3-(3-oxopiperazin-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCN2CCNC(=O)C2)CCCC1 |
| InChI | InChI=1S/C21H27N3O3/c1-27-21(26)15-7-8-19-17(13-15)16-5-2-3-6-18(16)24(19)11-4-10-23-12-9-22-20(25)14-23/h7-8,13H,2-6,9-12,14H2,1H3,(H,22,25) |
| InChIKey | QHODDOIWBPCRRL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|