About 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid
2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid (PubChem CID 57400864) has the molecular formula C33H33NO4
and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid |
| PubChem CID | 57400864 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CCCN(CCC(c2ccccc2)c2ccccc2)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H33NO4/c35-32(36)25-38-30-20-10-12-26(24-30)13-11-22-34(33(37)29-18-8-3-9-19-29)23-21-31(27-14-4-1-5-15-27)28-16-6-2-7-17-28/h1-10,12,14-20,24,31H,11,13,21-23,25H2,(H,35,36) |
| InChIKey | ZZXUPECLXIJHQB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid?
The IUPAC name of 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid (CID 57400864) is 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid?
The canonical SMILES for 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid is O=C(O)COc1cccc(CCCN(CCC(c2ccccc2)c2ccccc2)C(=O)c2ccccc2)c1.
What is the InChIKey of 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid?
The InChIKey is ZZXUPECLXIJHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H33NO4/c35-32(36)25-38-30-20-10-12-26(24-30)13-11-22-34(33(37)29-18-8-3-9-19-29)23-21-31(27-14-4-1-5-15-27)28-16-6-2-7-17-28/h1-10,12,14-20,24,31H,11,13,21-23,25H2,(H,35,36).
What are the key properties of 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid?
2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid has a molecular weight of 507.63 g/mol, XLogP of 6.45, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[benzoyl(3,3-diphenylpropyl)amino]propyl]phenoxy]acetic acid is sourced from PubChem (CID 57400864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).