C25H24N4O4 — CID 57401022
15-(4-oxo-4-piperazin-1-ylbutanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione (PubChem CID 57401022) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 15-(4-oxo-4-piperazin-1-ylbutanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione.
| Compound Name | 15-(4-oxo-4-piperazin-1-ylbutanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
|---|---|
| PubChem CID | 57401022 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 15-(4-oxo-4-piperazin-1-ylbutanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
| SMILES | O=C(CCC(=O)N1CCNCC1)c1ccc2[nH]c3c4c(c5c(c3c2c1)C(=O)NC5=O)CCC4 |
| InChI | InChI=1S/C25H24N4O4/c30-18(6-7-19(31)29-10-8-26-9-11-29)13-4-5-17-16(12-13)20-22-21(24(32)28-25(22)33)14-2-1-3-15(14)23(20)27-17/h4-5,12,26-27H,1-3,6-11H2,(H,28,32,33) |
| InChIKey | CWYBOMZPIGUTEV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|