C19H27N3O2 — CID 57401094
2-methyl-6-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-4,5-dihydropyridazin-3-one (PubChem CID 57401094) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-methyl-6-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-4,5-dihydropyridazin-3-one.
| Compound Name | 2-methyl-6-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 57401094 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-methyl-6-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-4,5-dihydropyridazin-3-one |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(C2=NN(C)C(=O)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O2/c1-15-5-3-12-22(15)13-4-14-24-17-8-6-16(7-9-17)18-10-11-19(23)21(2)20-18/h6-9,15H,3-5,10-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | MCRIGRHXRPURON-OAHLLOKOSA-N |
| XLogP | 2.90 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|