About 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride
1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride (PubChem CID 57401123) has the molecular formula C16H25ClN4
and a molecular weight of 308.86 g/mol. Its IUPAC name is 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride |
| PubChem CID | 57401123 |
| Molecular Formula | C16H25ClN4 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride |
| SMILES | CC1(C)CCCN(CCCn2nnc3ccccc32)C1.Cl |
| InChI | InChI=1S/C16H24N4.ClH/c1-16(2)9-5-10-19(13-16)11-6-12-20-15-8-4-3-7-14(15)17-18-20;/h3-4,7-8H,5-6,9-13H2,1-2H3;1H |
| InChIKey | ISPJCNFCCDWYPR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride?
The IUPAC name of 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride (CID 57401123) is 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride.
What is the SMILES notation for 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride?
The canonical SMILES for 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride is CC1(C)CCCN(CCCn2nnc3ccccc32)C1.Cl.
What is the InChIKey of 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride?
The InChIKey is ISPJCNFCCDWYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4.ClH/c1-16(2)9-5-10-19(13-16)11-6-12-20-15-8-4-3-7-14(15)17-18-20;/h3-4,7-8H,5-6,9-13H2,1-2H3;1H.
What are the key properties of 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride?
1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride has a molecular weight of 308.86 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,3-dimethylpiperidin-1-yl)propyl]benzotriazole;hydrochloride is sourced from PubChem (CID 57401123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).