C27H32FN7O2S — CID 57401173
N-tert-butyl-3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide (PubChem CID 57401173) has the molecular formula C27H32FN7O2S and a molecular weight of 537.67 g/mol. Its IUPAC name is N-tert-butyl-3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide.
| Compound Name | N-tert-butyl-3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57401173 |
| Molecular Formula | C27H32FN7O2S |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-tert-butyl-3-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5cccc(S(=O)(=O)NC(C)(C)C)c5)n4n3)cc2F)CC1 |
| InChI | InChI=1S/C27H32FN7O2S/c1-27(2,3)32-38(36,37)22-7-5-6-19(16-22)24-11-9-21-18-29-26(31-35(21)24)30-20-8-10-25(23(28)17-20)34-14-12-33(4)13-15-34/h5-11,16-18,32H,12-15H2,1-4H3,(H,30,31) |
| InChIKey | DYDMXIWYULAKCW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|