About [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate
[1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 57401394) has the molecular formula C28H31N3O4
and a molecular weight of 473.57 g/mol. Its IUPAC name is [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
Molecular Properties
| Compound Name | [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| PubChem CID | 57401394 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC1CC(=O)N(c2ccccc2C(=O)OCC2CCCN(CCc3c[nH]c4ccccc34)C2)C1=O |
| InChI | InChI=1S/C28H31N3O4/c1-19-15-26(32)31(27(19)33)25-11-5-3-9-23(25)28(34)35-18-20-7-6-13-30(17-20)14-12-21-16-29-24-10-4-2-8-22(21)24/h2-5,8-11,16,19-20,29H,6-7,12-15,17-18H2,1H3 |
| InChIKey | IQUGSVUQLUMNAQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
The IUPAC name of [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (CID 57401394) is [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
What is the SMILES notation for [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
The canonical SMILES for [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate is CC1CC(=O)N(c2ccccc2C(=O)OCC2CCCN(CCc3c[nH]c4ccccc34)C2)C1=O.
What is the InChIKey of [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
The InChIKey is IQUGSVUQLUMNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31N3O4/c1-19-15-26(32)31(27(19)33)25-11-5-3-9-23(25)28(34)35-18-20-7-6-13-30(17-20)14-12-21-16-29-24-10-4-2-8-22(21)24/h2-5,8-11,16,19-20,29H,6-7,12-15,17-18H2,1H3.
What are the key properties of [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
[1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate has a molecular weight of 473.57 g/mol, XLogP of 4.18, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1H-indol-3-yl)ethyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate is sourced from PubChem (CID 57401394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).