C28H31N2S+ — CID 57401431
N,N-dimethyl-4-[(E)-2-[3-(5-phenylpentyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline (PubChem CID 57401431) has the molecular formula C28H31N2S+ and a molecular weight of 427.64 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[3-(5-phenylpentyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[3-(5-phenylpentyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 57401431 |
| Molecular Formula | C28H31N2S+ |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[3-(5-phenylpentyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2sc3ccccc3[n+]2CCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N2S/c1-29(2)25-19-16-24(17-20-25)18-21-28-30(26-14-8-9-15-27(26)31-28)22-10-4-7-13-23-11-5-3-6-12-23/h3,5-6,8-9,11-12,14-21H,4,7,10,13,22H2,1-2H3/q+1 |
| InChIKey | BQKIBOLMIDESIW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|