About 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol
4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 57401441) has the molecular formula C22H26F2N6O2
and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol |
| PubChem CID | 57401441 |
| Molecular Formula | C22H26F2N6O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2ncc3nc(Nc4ccc(F)cc4F)n(C4CCOCC4)c3n2)CC1 |
| InChI | InChI=1S/C22H26F2N6O2/c23-13-1-6-18(17(24)11-13)27-22-28-19-12-25-21(26-14-2-4-16(31)5-3-14)29-20(19)30(22)15-7-9-32-10-8-15/h1,6,11-12,14-16,31H,2-5,7-10H2,(H,27,28)(H,25,26,29) |
| InChIKey | SEENQGCHZHJXQG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol?
The IUPAC name of 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol (CID 57401441) is 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol?
The canonical SMILES for 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol is OC1CCC(Nc2ncc3nc(Nc4ccc(F)cc4F)n(C4CCOCC4)c3n2)CC1.
What is the InChIKey of 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol?
The InChIKey is SEENQGCHZHJXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26F2N6O2/c23-13-1-6-18(17(24)11-13)27-22-28-19-12-25-21(26-14-2-4-16(31)5-3-14)29-20(19)30(22)15-7-9-32-10-8-15/h1,6,11-12,14-16,31H,2-5,7-10H2,(H,27,28)(H,25,26,29).
What are the key properties of 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol?
4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol has a molecular weight of 444.49 g/mol, XLogP of 3.91, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 57401441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).