C24H29F2N5O2 — CID 57401443
2-[(1S,3R)-3-[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]cyclopentyl]propan-2-ol (PubChem CID 57401443) has the molecular formula C24H29F2N5O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]cyclopentyl]propan-2-ol.
| Compound Name | 2-[(1S,3R)-3-[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]cyclopentyl]propan-2-ol |
|---|---|
| PubChem CID | 57401443 |
| Molecular Formula | C24H29F2N5O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-[(1S,3R)-3-[8-(2,4-difluoroanilino)-9-(oxan-4-yl)purin-2-yl]cyclopentyl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CC[C@@H](c2ncc3nc(Nc4ccc(F)cc4F)n(C4CCOCC4)c3n2)C1 |
| InChI | InChI=1S/C24H29F2N5O2/c1-24(2,32)15-4-3-14(11-15)21-27-13-20-22(30-21)31(17-7-9-33-10-8-17)23(29-20)28-19-6-5-16(25)12-18(19)26/h5-6,12-15,17,32H,3-4,7-11H2,1-2H3,(H,28,29)/t14-,15+/m1/s1 |
| InChIKey | JPJFWEVMWXMYLI-CABCVRRESA-N |
| XLogP | 4.85 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |