C18H22N6O2S2 — CID 57401674
N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 57401674) has the molecular formula C18H22N6O2S2 and a molecular weight of 418.55 g/mol. Its IUPAC name is N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 57401674 |
| Molecular Formula | C18H22N6O2S2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2ccncc2)CC1)c1cccc2nsnc12 |
| InChI | InChI=1S/C18H22N6O2S2/c25-28(26,17-4-1-3-16-18(17)22-27-21-16)20-7-2-10-23-11-13-24(14-12-23)15-5-8-19-9-6-15/h1,3-6,8-9,20H,2,7,10-14H2 |
| InChIKey | LEWWKRQZLFEBAY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|