C20H25N5O3 — CID 57401759
4-[[4-ethyl-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 57401759) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[[4-ethyl-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-[[4-ethyl-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 57401759 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[[4-ethyl-6-(2-methoxyethoxy)-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | CCc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCCOC)n1 |
| InChI | InChI=1S/C20H25N5O3/c1-5-18-23-19(25-20(24-18)28-11-10-26-4)22-16-7-6-15(13-21)17(12-16)27-9-8-14(2)3/h6-8,12H,5,9-11H2,1-4H3,(H,22,23,24,25) |
| InChIKey | PLHGHBBCPPRTHY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|