C34H38N12O4 — CID 57401761
4-[[4-[2-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]ethylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile (PubChem CID 57401761) has the molecular formula C34H38N12O4 and a molecular weight of 678.76 g/mol. Its IUPAC name is 4-[[4-[2-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]ethylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile.
| Compound Name | 4-[[4-[2-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]ethylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
|---|---|
| PubChem CID | 57401761 |
| Molecular Formula | C34H38N12O4 |
| Molecular Weight | 678.76 g/mol |
| Exact Mass | 678.31 |
| IUPAC Name | 4-[[4-[2-[[4-[4-cyano-3-(3-methylbut-2-enoxy)anilino]-6-methoxy-1,3,5-triazin-2-yl]amino]ethylamino]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-(3-methylbut-2-enoxy)benzonitrile |
| SMILES | COc1nc(NCCNc2nc(Nc3ccc(C#N)c(OCC=C(C)C)c3)nc(OC)n2)nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)n1 |
| InChI | InChI=1S/C34H38N12O4/c1-21(2)11-15-49-27-17-25(9-7-23(27)19-35)39-31-41-29(43-33(45-31)47-5)37-13-14-38-30-42-32(46-34(44-30)48-6)40-26-10-8-24(20-36)28(18-26)50-16-12-22(3)4/h7-12,17-18H,13-16H2,1-6H3,(H2,37,39,41,43,45)(H2,38,40,42,44,46) |
| InChIKey | TVDLSIICCRCHST-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 209.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|