About [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate
[1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate (PubChem CID 57401843) has the molecular formula C25H29N3O3
and a molecular weight of 419.53 g/mol. Its IUPAC name is [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate.
Molecular Properties
| Compound Name | [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate |
| PubChem CID | 57401843 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate |
| SMILES | NCCC[C@@H](N)C(=O)OC(CCc1ccccc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H29N3O3/c26-16-6-11-22(27)25(30)31-23(15-12-18-7-2-1-3-8-18)24(29)28-21-14-13-19-9-4-5-10-20(19)17-21/h1-5,7-10,13-14,17,22-23H,6,11-12,15-16,26-27H2,(H,28,29)/t22-,23?/m1/s1 |
| InChIKey | WBIBPEKIBCUMPF-WTQRLHSKSA-N |
| XLogP | 3.39 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate?
The IUPAC name of [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate (CID 57401843) is [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate.
What is the SMILES notation for [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate?
The canonical SMILES for [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate is NCCC[C@@H](N)C(=O)OC(CCc1ccccc1)C(=O)Nc1ccc2ccccc2c1.
What is the InChIKey of [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate?
The InChIKey is WBIBPEKIBCUMPF-WTQRLHSKSA-N. The full InChI is InChI=1S/C25H29N3O3/c26-16-6-11-22(27)25(30)31-23(15-12-18-7-2-1-3-8-18)24(29)28-21-14-13-19-9-4-5-10-20(19)17-21/h1-5,7-10,13-14,17,22-23H,6,11-12,15-16,26-27H2,(H,28,29)/t22-,23?/m1/s1.
What are the key properties of [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate?
[1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate has a molecular weight of 419.53 g/mol, XLogP of 3.39, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(naphthalen-2-ylamino)-1-oxo-4-phenylbutan-2-yl] (2R)-2,5-diaminopentanoate is sourced from PubChem (CID 57401843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).