About 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol
5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol (PubChem CID 57401928) has the molecular formula C16H13I2N3O3
and a molecular weight of 549.11 g/mol. Its IUPAC name is 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol |
| PubChem CID | 57401928 |
| Molecular Formula | C16H13I2N3O3 |
| Molecular Weight | 549.11 g/mol |
| Exact Mass | 548.90 |
| IUPAC Name | 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2cnnn2-c2cc(I)c(OC)c(I)c2)cc1O |
| InChI | InChI=1S/C16H13I2N3O3/c1-23-15-4-3-9(5-14(15)22)13-8-19-20-21(13)10-6-11(17)16(24-2)12(18)7-10/h3-8,22H,1-2H3 |
| InChIKey | DGKAKWFEDKWUIO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 549.11 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol?
The IUPAC name of 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol (CID 57401928) is 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol.
What is the SMILES notation for 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol?
The canonical SMILES for 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol is COc1ccc(-c2cnnn2-c2cc(I)c(OC)c(I)c2)cc1O.
What is the InChIKey of 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol?
The InChIKey is DGKAKWFEDKWUIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13I2N3O3/c1-23-15-4-3-9(5-14(15)22)13-8-19-20-21(13)10-6-11(17)16(24-2)12(18)7-10/h3-8,22H,1-2H3.
What are the key properties of 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol?
5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol has a molecular weight of 549.11 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,5-diiodo-4-methoxyphenyl)triazol-4-yl]-2-methoxyphenol is sourced from PubChem (CID 57401928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).